CAS 1820598-59-1 appears in our catalog under these names: Fmoc-(r,s)-3,4-cis-methanoproline, 95%, Fmoc-3,4-cis-methanoproline, 99%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
(1S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 1820598-59-1) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (1S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: BTOGCFAOJIQONJ-OWVMMGIVSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (1S,5R)-3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | BTOGCFAOJIQONJ-OWVMMGIVSA-N |
| SMILES | C1[C@@H]2[C@H]1C(N(C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)