CAS 1820598-65-9 is the registry number for methyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (CAS 1820598-65-9) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: methyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate. InChIKey: RMAZRAQKPTXZNL-KVARREAHSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | methyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| InChIKey | RMAZRAQKPTXZNL-KVARREAHSA-N |
| SMILES | COC(=O)C1C[C@H]2C[C@@H]1C=C2 |
Computed by PubChem (NCBI)