CAS 1820603-90-4 is the registry number for 2,4-Bis(Benzyloxy)-1-methanesulfonylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-methylsulfonyl-2,4-bis(phenylmethoxy)benzene (CAS 1820603-90-4) is a chemical compound with the molecular formula C21H20O4S and a molecular weight of 368.4 g/mol. IUPAC name: 1-methylsulfonyl-2,4-bis(phenylmethoxy)benzene. InChIKey: FOGKNBZOGLTXJL-UHFFFAOYSA-N.
| Molecular formula | C21H20O4S |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 1-methylsulfonyl-2,4-bis(phenylmethoxy)benzene |
| InChIKey | FOGKNBZOGLTXJL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)