CAS 1820607-08-6 is the registry number for 3-(Methoxy-d3)aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(trideuteriomethoxy)aniline;hydrochloride (CAS 1820607-08-6) is a chemical compound with the molecular formula C7H10ClNO and a molecular weight of 162.63 g/mol. IUPAC name: 3-(trideuteriomethoxy)aniline;hydrochloride. InChIKey: FNCKZWCTEPKMQV-NIIDSAIPSA-N.
| Molecular formula | C7H10ClNO |
|---|---|
| Molecular weight | 162.63 g/mol |
| IUPAC name | 3-(trideuteriomethoxy)aniline;hydrochloride |
| InChIKey | FNCKZWCTEPKMQV-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1)N.Cl |
Computed by PubChem (NCBI)