Products 1820607-18-8
CAS 1820607-18-8 is the registry number for 2-amino-1,3-benzoxazol-6-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-1,3-benzoxazol-6-ol;hydrochloride (CAS 1820607-18-8) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-amino-1,3-benzoxazol-6-ol;hydrochloride. InChIKey: MSDWTZOSPBQNHO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-amino-1,3-benzoxazol-6-ol;hydrochloride |
| InChIKey | MSDWTZOSPBQNHO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=N2)N.Cl |
Computed by PubChem (NCBI)