CAS 1820613-32-8 is the registry number for 4-Sulfobutane-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chlorosulfonylbutane-1-sulfonyl fluoride (CAS 1820613-32-8) is a chemical compound with the molecular formula C4H8ClFO4S2 and a molecular weight of 238.7 g/mol. IUPAC name: 4-chlorosulfonylbutane-1-sulfonyl fluoride. InChIKey: VEGCRKVLGGDVQS-UHFFFAOYSA-N.
| Molecular formula | C4H8ClFO4S2 |
|---|---|
| Molecular weight | 238.7 g/mol |
| IUPAC name | 4-chlorosulfonylbutane-1-sulfonyl fluoride |
| InChIKey | VEGCRKVLGGDVQS-UHFFFAOYSA-N |
| SMILES | C(CCS(=O)(=O)Cl)CS(=O)(=O)F |
Computed by PubChem (NCBI)