Products 1820613-66-8

CAS 1820613-66-8 is the registry number for methyl 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetate (CAS 1820613-66-8) is a chemical compound with the molecular formula C10H7F5O3 and a molecular weight of 270.15 g/mol. IUPAC name: methyl 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetate. InChIKey: CTCCTVRCRSDKEB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F5O3
Molecular weight270.15 g/mol
IUPAC namemethyl 2,2-difluoro-2-[2-(trifluoromethoxy)phenyl]acetate
InChIKeyCTCCTVRCRSDKEB-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC=CC=C1OC(F)(F)F)(F)F

Computed by PubChem (NCBI)