CAS 2490233-72-0 is the registry number for 3-(2,2-Difluoroethoxy)-5-(trifluoromethyl)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(2,2-difluoroethoxy)-5-(trifluoromethyl)benzoic acid (CAS 2490233-72-0) is a chemical compound with the molecular formula C10H7F5O3 and a molecular weight of 270.15 g/mol. IUPAC name: 3-(2,2-difluoroethoxy)-5-(trifluoromethyl)benzoic acid. InChIKey: KDAQZLLOHBKPEG-UHFFFAOYSA-N.
| Molecular formula | C10H7F5O3 |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 3-(2,2-difluoroethoxy)-5-(trifluoromethyl)benzoic acid |
| InChIKey | KDAQZLLOHBKPEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)OCC(F)F)C(=O)O |
Computed by PubChem (NCBI)