Products 1820613-80-6
CAS 1820613-80-6 is the registry number for Methyl 5-nitro-6-(propylamino)pyridine-3-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 5-nitro-6-(propylamino)pyridine-3-carboxylate (CAS 1820613-80-6) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: methyl 5-nitro-6-(propylamino)pyridine-3-carboxylate. InChIKey: QFCVJPWYAKLCNM-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | methyl 5-nitro-6-(propylamino)pyridine-3-carboxylate |
| InChIKey | QFCVJPWYAKLCNM-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=C(C=N1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)