Products 763867-43-2
CAS 763867-43-2 is the registry number for Ancitabine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol (CAS 763867-43-2) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: (2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol. InChIKey: KEVADKNLSHPHHV-JAGXHNFQSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | (2R,4R,5R,6S)-4-(hydroxymethyl)-10-imino-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-ol |
| InChIKey | KEVADKNLSHPHHV-JAGXHNFQSA-N |
| SMILES | CC1=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)OC2=NC1=N |
Computed by PubChem (NCBI)
Synonyms:
Ancitabine Impurity 3