CAS 1820619-59-7 appears in our catalog under these names: 1-Bromo-4-iodo-2-(methylsulfonyl)benzene, 95%, 1-Bromo-4-iodo-2-(methylsulfonyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1-bromo-4-iodo-2-methylsulfonylbenzene (CAS 1820619-59-7) is a chemical compound with the molecular formula C7H6BrIO2S and a molecular weight of 361.00 g/mol. IUPAC name: 1-bromo-4-iodo-2-methylsulfonylbenzene. InChIKey: HOISVHLEEWJWML-UHFFFAOYSA-N.
| Molecular formula | C7H6BrIO2S |
|---|---|
| Molecular weight | 361.00 g/mol |
| IUPAC name | 1-bromo-4-iodo-2-methylsulfonylbenzene |
| InChIKey | HOISVHLEEWJWML-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)I)Br |
Computed by PubChem (NCBI)