Products 1820619-81-5

CAS 1820619-81-5 appears in our catalog under these names: 1-(Propan-2-yl)cyclopropane-1-sulfonyl chloride, 95%, 1-(Propan-2-yl)cyclopropane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1-propan-2-ylcyclopropane-1-sulfonyl chloride (CAS 1820619-81-5) is a chemical compound with the molecular formula C6H11ClO2S and a molecular weight of 182.67 g/mol. IUPAC name: 1-propan-2-ylcyclopropane-1-sulfonyl chloride. InChIKey: JEERJZUNIBOLOX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO2S
Molecular weight182.67 g/mol
IUPAC name1-propan-2-ylcyclopropane-1-sulfonyl chloride
InChIKeyJEERJZUNIBOLOX-UHFFFAOYSA-N
SMILESCC(C)C1(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)