CAS 1820639-99-3 appears in our catalog under these names: 3-Fluoro-4-piperazinobenzoic acid hydrochloride, 96%, 3-Fluoro-4-(piperazin-1-yl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-fluoro-4-piperazin-1-ylbenzoic acid;hydrochloride (CAS 1820639-99-3) is a chemical compound with the molecular formula C11H14ClFN2O2 and a molecular weight of 260.69 g/mol. IUPAC name: 3-fluoro-4-piperazin-1-ylbenzoic acid;hydrochloride. InChIKey: NPDNXNJVVFDWPK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2O2 |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | 3-fluoro-4-piperazin-1-ylbenzoic acid;hydrochloride |
| InChIKey | NPDNXNJVVFDWPK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)C(=O)O)F.Cl |
Computed by PubChem (NCBI)