CAS 1820640-14-9 is the registry number for 1-(4-Bromo-2-chlorophenyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 25g, 10g.
1-(4-bromo-2-chlorophenyl)piperazine;hydrochloride (CAS 1820640-14-9) is a chemical compound with the molecular formula C10H13BrCl2N2 and a molecular weight of 312.03 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)piperazine;hydrochloride. InChIKey: SQAKDWFGDRKOLU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrCl2N2 |
|---|---|
| Molecular weight | 312.03 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)piperazine;hydrochloride |
| InChIKey | SQAKDWFGDRKOLU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)Br)Cl.Cl |
Computed by PubChem (NCBI)