Products 1820640-24-1

CAS 1820640-24-1 is the registry number for methyl 2-{4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetate (CAS 1820640-24-1) is a chemical compound with the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. IUPAC name: methyl 2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetate. InChIKey: SWYFTXPIISTGIO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12F4O2
Molecular weight312.26 g/mol
IUPAC namemethyl 2-[4-[4-fluoro-3-(trifluoromethyl)phenyl]phenyl]acetate
InChIKeySWYFTXPIISTGIO-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC=C(C=C1)C2=CC(=C(C=C2)F)C(F)(F)F

Computed by PubChem (NCBI)