Products 1820647-14-0
CAS 1820647-14-0 is the registry number for methyl 5-(3,5-dimethylphenyl)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 5-(3,5-dimethylphenyl)pyridine-3-carboxylate (CAS 1820647-14-0) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 5-(3,5-dimethylphenyl)pyridine-3-carboxylate. InChIKey: AARWYOUKZFABMQ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl 5-(3,5-dimethylphenyl)pyridine-3-carboxylate |
| InChIKey | AARWYOUKZFABMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=CN=C2)C(=O)OC)C |
Computed by PubChem (NCBI)