Products 1393442-25-5
CAS 1393442-25-5 is the registry number for Methyl 6-(3,5-dimethylphenyl)pyridine-2-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 6-(3,5-dimethylphenyl)pyridine-2-carboxylate (CAS 1393442-25-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 6-(3,5-dimethylphenyl)pyridine-2-carboxylate. InChIKey: DPBZSEVBQICUCW-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl 6-(3,5-dimethylphenyl)pyridine-2-carboxylate |
| InChIKey | DPBZSEVBQICUCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC(=CC=C2)C(=O)OC)C |
Computed by PubChem (NCBI)