CAS 1820648-01-8 is the registry number for 6-Iodo-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-iodo-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (CAS 1820648-01-8) is a chemical compound with the molecular formula C7H6IN3O2 and a molecular weight of 291.05 g/mol. IUPAC name: 4-iodo-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile. InChIKey: QDHFQOPJUKRABQ-UHFFFAOYSA-N.
| Molecular formula | C7H6IN3O2 |
|---|---|
| Molecular weight | 291.05 g/mol |
| IUPAC name | 4-iodo-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| InChIKey | QDHFQOPJUKRABQ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C#N)I |
Computed by PubChem (NCBI)