CAS 1820648-17-6 is the registry number for methyl 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylate (CAS 1820648-17-6) is a chemical compound with the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. IUPAC name: methyl 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylate. InChIKey: IQMIPJVSRHCRQC-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O3 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | methyl 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylate |
| InChIKey | IQMIPJVSRHCRQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1F)N=C(O2)N |
Computed by PubChem (NCBI)