CAS 1083245-77-5 is the registry number for 2-(5-Fluoro-2-oxo-2,3-dihydrobenzo[d]imidazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(5-fluoro-2-oxo-3H-benzimidazol-1-yl)acetic acid (CAS 1083245-77-5) is a chemical compound with the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. IUPAC name: 2-(5-fluoro-2-oxo-3H-benzimidazol-1-yl)acetic acid. InChIKey: JNNDPCUHYCZTCB-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O3 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | 2-(5-fluoro-2-oxo-3H-benzimidazol-1-yl)acetic acid |
| InChIKey | JNNDPCUHYCZTCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)N2CC(=O)O |
Computed by PubChem (NCBI)