CAS 1820651-41-9 is the registry number for 7-Chloro-[1,3]thiazolo[4,5-d]pyrimidine-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-3H-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (CAS 1820651-41-9) is a chemical compound with the molecular formula C5H2ClN3S2 and a molecular weight of 203.7 g/mol. IUPAC name: 7-chloro-3H-[1,3]thiazolo[4,5-d]pyrimidine-2-thione. InChIKey: JEEZEVISECGTRZ-UHFFFAOYSA-N.
| Molecular formula | C5H2ClN3S2 |
|---|---|
| Molecular weight | 203.7 g/mol |
| IUPAC name | 7-chloro-3H-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| InChIKey | JEEZEVISECGTRZ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=N1)Cl)SC(=S)N2 |
Computed by PubChem (NCBI)