CAS 1820664-68-3 is the registry number for 3,3,3-Trifluoro-1-(1-phenyl-1H-pyrazol-4-yl)propan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,3,3-trifluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine;hydrochloride (CAS 1820664-68-3) is a chemical compound with the molecular formula C12H13ClF3N3 and a molecular weight of 291.70 g/mol. IUPAC name: 3,3,3-trifluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine;hydrochloride. InChIKey: TZVAKJBOFNZGHT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N3 |
|---|---|
| Molecular weight | 291.70 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-(1-phenylpyrazol-4-yl)propan-1-amine;hydrochloride |
| InChIKey | TZVAKJBOFNZGHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=N2)C(CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)