Products 1820664-96-7
CAS 1820664-96-7 appears in our catalog under these names: 3-(2-Methylpropane-2-sulfonyl)azetidine hydrochloride, 98%, 3-(tert-Butylsulfonyl)azetidine hydrochloride, 98%, 3-(2-Methylpropane-2-sulfonyl)azetidine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-tert-butylsulfonylazetidine;hydrochloride (CAS 1820664-96-7) is a chemical compound with the molecular formula C7H16ClNO2S and a molecular weight of 213.73 g/mol. IUPAC name: 3-tert-butylsulfonylazetidine;hydrochloride. InChIKey: YYVHNBYHPHPZAX-UHFFFAOYSA-N.
| Molecular formula | C7H16ClNO2S |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 3-tert-butylsulfonylazetidine;hydrochloride |
| InChIKey | YYVHNBYHPHPZAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)C1CNC1.Cl |
Computed by PubChem (NCBI)