Products 1820665-33-5
CAS 1820665-33-5 is the registry number for 7-Bromo-1-methyl-5-(trifluoromethyl)-3H-1,3-benzodiazol-2-one, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-bromo-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one (CAS 1820665-33-5) is a chemical compound with the molecular formula C9H6BrF3N2O and a molecular weight of 295.06 g/mol. IUPAC name: 4-bromo-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one. InChIKey: CCUVJJKLELBSSP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2O |
|---|---|
| Molecular weight | 295.06 g/mol |
| IUPAC name | 4-bromo-3-methyl-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| InChIKey | CCUVJJKLELBSSP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2Br)C(F)(F)F)NC1=O |
Computed by PubChem (NCBI)