CAS 1820666-05-4 is the registry number for 6-Bromo-4,5-difluoro-1,3-dihydro-1,3-benzodiazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-4,5-difluoro-1,3-dihydrobenzimidazol-2-one (CAS 1820666-05-4) is a chemical compound with the molecular formula C7H3BrF2N2O and a molecular weight of 249.01 g/mol. IUPAC name: 6-bromo-4,5-difluoro-1,3-dihydrobenzimidazol-2-one. InChIKey: OLMUQQPXHINYKG-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2N2O |
|---|---|
| Molecular weight | 249.01 g/mol |
| IUPAC name | 6-bromo-4,5-difluoro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | OLMUQQPXHINYKG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Br)F)F)NC(=O)N2 |
Computed by PubChem (NCBI)