CAS 182067-45-4 is the registry number for 3-(Benzoyloxy)-5-chloro-2-hydroxybenzoic Acid. Offered by: TRC. Available pack sizes: 50mg.
3-benzoyloxy-5-chloro-2-hydroxybenzoic acid (CAS 182067-45-4) is a chemical compound with the molecular formula C14H9ClO5 and a molecular weight of 292.67 g/mol. IUPAC name: 3-benzoyloxy-5-chloro-2-hydroxybenzoic acid. InChIKey: YMLURTKRDUNBNX-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO5 |
|---|---|
| Molecular weight | 292.67 g/mol |
| IUPAC name | 3-benzoyloxy-5-chloro-2-hydroxybenzoic acid |
| InChIKey | YMLURTKRDUNBNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC(=CC(=C2O)C(=O)O)Cl |
Computed by PubChem (NCBI)