CAS 1820673-56-0 is the registry number for (2,6-dichloro-3-fluorophenyl)-2-oxoacetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,6-dichloro-3-fluorophenyl)-2-oxoacetic acid (CAS 1820673-56-0) is a chemical compound with the molecular formula C8H3Cl2FO3 and a molecular weight of 237.01 g/mol. IUPAC name: 2-(2,6-dichloro-3-fluorophenyl)-2-oxoacetic acid. InChIKey: YIFUMRYRMXUAFN-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2FO3 |
|---|---|
| Molecular weight | 237.01 g/mol |
| IUPAC name | 2-(2,6-dichloro-3-fluorophenyl)-2-oxoacetic acid |
| InChIKey | YIFUMRYRMXUAFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Cl)C(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)