Products 1820674-87-0

CAS 1820674-87-0 is the registry number for 3-Bromo-5-chloro-2-methoxyaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-bromo-5-chloro-2-methoxyaniline;hydrochloride (CAS 1820674-87-0) is a chemical compound with the molecular formula C7H8BrCl2NO and a molecular weight of 272.95 g/mol. IUPAC name: 3-bromo-5-chloro-2-methoxyaniline;hydrochloride. InChIKey: ZRKIYQQCNGGSIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BrCl2NO
Molecular weight272.95 g/mol
IUPAC name3-bromo-5-chloro-2-methoxyaniline;hydrochloride
InChIKeyZRKIYQQCNGGSIJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1Br)Cl)N.Cl

Computed by PubChem (NCBI)