CAS 1820679-71-7 is the registry number for tert-Butyl (R)-4-amino-3,3-difluoropiperidine-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate;hydrochloride (CAS 1820679-71-7) is a chemical compound with the molecular formula C10H19ClF2N2O2 and a molecular weight of 272.72 g/mol. IUPAC name: tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate;hydrochloride. InChIKey: JWXQXPJNBJVLQW-OGFXRTJISA-N.
| Molecular formula | C10H19ClF2N2O2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate;hydrochloride |
| InChIKey | JWXQXPJNBJVLQW-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(C1)(F)F)N.Cl |
Computed by PubChem (NCBI)