Products 1820683-89-3
CAS 1820683-89-3 is the registry number for N-{2-[(4-Nitrophenyl)amino]ethyl}cyclohexanamine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-cyclohexyl-N'-(4-nitrophenyl)ethane-1,2-diamine (CAS 1820683-89-3) is a chemical compound with the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. IUPAC name: N-cyclohexyl-N'-(4-nitrophenyl)ethane-1,2-diamine. InChIKey: WJXJONRIOYVDBH-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O2 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | N-cyclohexyl-N'-(4-nitrophenyl)ethane-1,2-diamine |
| InChIKey | WJXJONRIOYVDBH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NCCNC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)