CAS 1820684-04-5 is the registry number for 4-bromo-2-(3-hydroxyazetidin-1-yl)benzo(d)thiazole-6-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2-(3-hydroxyazetidin-1-yl)-1,3-benzothiazole-6-carboxylic acid (CAS 1820684-04-5) is a chemical compound with the molecular formula C11H9BrN2O3S and a molecular weight of 329.17 g/mol. IUPAC name: 4-bromo-2-(3-hydroxyazetidin-1-yl)-1,3-benzothiazole-6-carboxylic acid. InChIKey: RXHGWZNASQPBLM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3S |
|---|---|
| Molecular weight | 329.17 g/mol |
| IUPAC name | 4-bromo-2-(3-hydroxyazetidin-1-yl)-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | RXHGWZNASQPBLM-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC3=C(S2)C=C(C=C3Br)C(=O)O)O |
Computed by PubChem (NCBI)