CAS 1820687-70-4 is the registry number for 1–(5–(aminomethyl)–2–methoxyphenyl)–n,n–dimethylmethanamine dihydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
[3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;dihydrochloride (CAS 1820687-70-4) is a chemical compound with the molecular formula C11H20Cl2N2O and a molecular weight of 267.19 g/mol. IUPAC name: [3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;dihydrochloride. InChIKey: FBTOPEIHCHMMAO-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2O |
|---|---|
| Molecular weight | 267.19 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;dihydrochloride |
| InChIKey | FBTOPEIHCHMMAO-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)CN)OC.Cl.Cl |
Computed by PubChem (NCBI)