CAS 1820688-00-3 is the registry number for 5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine;hydrochloride (CAS 1820688-00-3) is a chemical compound with the molecular formula C8H7Cl3N2O and a molecular weight of 253.5 g/mol. IUPAC name: 5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine;hydrochloride. InChIKey: CNEYXQWJWNSGJR-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O |
|---|---|
| Molecular weight | 253.5 g/mol |
| IUPAC name | 5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine;hydrochloride |
| InChIKey | CNEYXQWJWNSGJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Cl)OC(=N2)N)Cl.Cl |
Computed by PubChem (NCBI)