CAS 1820703-74-9 is the registry number for N,2-Bis(2-bromophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
N,2-bis(2-bromophenyl)acetamide (CAS 1820703-74-9) is a chemical compound with the molecular formula C14H11Br2NO and a molecular weight of 369.05 g/mol. IUPAC name: N,2-bis(2-bromophenyl)acetamide. InChIKey: HTDSDXQARVLUMA-UHFFFAOYSA-N.
| Molecular formula | C14H11Br2NO |
|---|---|
| Molecular weight | 369.05 g/mol |
| IUPAC name | N,2-bis(2-bromophenyl)acetamide |
| InChIKey | HTDSDXQARVLUMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=CC=CC=C2Br)Br |
Computed by PubChem (NCBI)