CAS 1820705-17-6 is the registry number for 2-Amino-5-bromo-4-chlorobenzoic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
2-amino-5-bromo-4-chlorobenzoic acid;hydrochloride (CAS 1820705-17-6) is a chemical compound with the molecular formula C7H6BrCl2NO2 and a molecular weight of 286.93 g/mol. IUPAC name: 2-amino-5-bromo-4-chlorobenzoic acid;hydrochloride. InChIKey: UQGITFMPBWGOKM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrCl2NO2 |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 2-amino-5-bromo-4-chlorobenzoic acid;hydrochloride |
| InChIKey | UQGITFMPBWGOKM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)N)C(=O)O.Cl |
Computed by PubChem (NCBI)