CAS 1820706-35-1 is the registry number for 2-bromo-6-(1-methylpyrazol-4-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-6-(1-methylpyrazol-4-yl)aniline (CAS 1820706-35-1) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 2-bromo-6-(1-methylpyrazol-4-yl)aniline. InChIKey: YOOVPGIVLNKTNG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 2-bromo-6-(1-methylpyrazol-4-yl)aniline |
| InChIKey | YOOVPGIVLNKTNG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=C(C(=CC=C2)Br)N |
Computed by PubChem (NCBI)