CAS 956986-52-0 appears in our catalog under these names: 1-(4-Bromobenzyl)-1h-pyrazol-5-amine, 95%, 1-(4-Bromobenzyl)-1H-pyrazol-5-amine 95%, 1-(4-Bromobenzyl)-1H-pyrazol-5-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(4-bromophenyl)methyl]pyrazol-3-amine (CAS 956986-52-0) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]pyrazol-3-amine. InChIKey: VBGXXWGGAZDXFZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]pyrazol-3-amine |
| InChIKey | VBGXXWGGAZDXFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=CC=N2)N)Br |
Computed by PubChem (NCBI)