CAS 1820707-60-5 appears in our catalog under these names: 7-Chloro-1-methyl-5-(trifluoromethyl)benzimidazole, 95%, 7-Chloro-1-methyl-5-(trifluoromethyl)-1H-benzo(d)imidazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
7-chloro-1-methyl-5-(trifluoromethyl)benzimidazole (CAS 1820707-60-5) is a chemical compound with the molecular formula C9H6ClF3N2 and a molecular weight of 234.60 g/mol. IUPAC name: 7-chloro-1-methyl-5-(trifluoromethyl)benzimidazole. InChIKey: KMNBZPCUCXJWCE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3N2 |
|---|---|
| Molecular weight | 234.60 g/mol |
| IUPAC name | 7-chloro-1-methyl-5-(trifluoromethyl)benzimidazole |
| InChIKey | KMNBZPCUCXJWCE-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)