CAS 1820707-76-3 is the registry number for methyl 3-(3,5-difluorophenyl)-5-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-(3,5-difluorophenyl)-5-(trifluoromethyl)benzoate (CAS 1820707-76-3) is a chemical compound with the molecular formula C15H9F5O2 and a molecular weight of 316.22 g/mol. IUPAC name: methyl 3-(3,5-difluorophenyl)-5-(trifluoromethyl)benzoate. InChIKey: YEBDCTJTIKUYPR-UHFFFAOYSA-N.
| Molecular formula | C15H9F5O2 |
|---|---|
| Molecular weight | 316.22 g/mol |
| IUPAC name | methyl 3-(3,5-difluorophenyl)-5-(trifluoromethyl)benzoate |
| InChIKey | YEBDCTJTIKUYPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC(=CC(=C2)F)F)C(F)(F)F |
Computed by PubChem (NCBI)