Products 1820710-89-1
CAS 1820710-89-1 is the registry number for methyl 3-(4-chlorophenyl)-5-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(4-chlorophenyl)-5-(trifluoromethyl)benzoate (CAS 1820710-89-1) is a chemical compound with the molecular formula C15H10ClF3O2 and a molecular weight of 314.68 g/mol. IUPAC name: methyl 3-(4-chlorophenyl)-5-(trifluoromethyl)benzoate. InChIKey: BKKPTJGQNMVVFH-UHFFFAOYSA-N.
| Molecular formula | C15H10ClF3O2 |
|---|---|
| Molecular weight | 314.68 g/mol |
| IUPAC name | methyl 3-(4-chlorophenyl)-5-(trifluoromethyl)benzoate |
| InChIKey | BKKPTJGQNMVVFH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)