Products 1820712-46-6

CAS 1820712-46-6 is the registry number for 3-(3-Amino-5-chloro-2-oxo-2h-pyrazin-1-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(3-amino-5-chloro-2-oxopyrazin-1-yl)benzoate (CAS 1820712-46-6) is a chemical compound with the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. IUPAC name: methyl 3-(3-amino-5-chloro-2-oxopyrazin-1-yl)benzoate. InChIKey: OKWNSMVGULDNMH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClN3O3
Molecular weight279.68 g/mol
IUPAC namemethyl 3-(3-amino-5-chloro-2-oxopyrazin-1-yl)benzoate
InChIKeyOKWNSMVGULDNMH-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC=C1)N2C=C(N=C(C2=O)N)Cl

Computed by PubChem (NCBI)