CAS 1820716-77-5 is the registry number for 1,3-dimethyl 5-[4-fluoro-3-(methoxycarbonyl)phenyl]benzene-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Dimethyl 5-(4-fluoro-3-methoxycarbonylphenyl)benzene-1,3-dicarboxylate (CAS 1820716-77-5) is a chemical compound with the molecular formula C18H15FO6 and a molecular weight of 346.3 g/mol. IUPAC name: dimethyl 5-(4-fluoro-3-methoxycarbonylphenyl)benzene-1,3-dicarboxylate. InChIKey: HMCNIOOKCVECQE-UHFFFAOYSA-N.
| Molecular formula | C18H15FO6 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | dimethyl 5-(4-fluoro-3-methoxycarbonylphenyl)benzene-1,3-dicarboxylate |
| InChIKey | HMCNIOOKCVECQE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC(=C(C=C2)F)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)