CAS 1820740-69-9 is the registry number for 4-Amino-3-(trifluoromethyl)phenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-amino-3-(trifluoromethyl)phenyl] trifluoromethanesulfonate (CAS 1820740-69-9) is a chemical compound with the molecular formula C8H5F6NO3S and a molecular weight of 309.19 g/mol. IUPAC name: [4-amino-3-(trifluoromethyl)phenyl] trifluoromethanesulfonate. InChIKey: CVXANEFQUAVFII-UHFFFAOYSA-N.
| Molecular formula | C8H5F6NO3S |
|---|---|
| Molecular weight | 309.19 g/mol |
| IUPAC name | [4-amino-3-(trifluoromethyl)phenyl] trifluoromethanesulfonate |
| InChIKey | CVXANEFQUAVFII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OS(=O)(=O)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)