CAS 1820813-94-2 is the registry number for Methyl 4-chloro-2-hydroxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-chloro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1820813-94-2) is a chemical compound with the molecular formula C14H18BClO5 and a molecular weight of 312.55 g/mol. IUPAC name: methyl 4-chloro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: LJPKSGGWHUOSLU-UHFFFAOYSA-N.
| Molecular formula | C14H18BClO5 |
|---|---|
| Molecular weight | 312.55 g/mol |
| IUPAC name | methyl 4-chloro-2-hydroxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | LJPKSGGWHUOSLU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)O)C(=O)OC |
Computed by PubChem (NCBI)