CAS 1821017-48-4 is the registry number for Tetrazine-sulfo-nhs ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Sodium 2,5-dioxo-1-[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]oxypyrrolidine-3-sulfonate (CAS 1821017-48-4) is a chemical compound with the molecular formula C14H10N5NaO7S and a molecular weight of 415.32 g/mol. IUPAC name: sodium 2,5-dioxo-1-[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]oxypyrrolidine-3-sulfonate. InChIKey: UCIIBAYVKAMDGO-UHFFFAOYSA-M.
| Molecular formula | C14H10N5NaO7S |
|---|---|
| Molecular weight | 415.32 g/mol |
| IUPAC name | sodium 2,5-dioxo-1-[2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetyl]oxypyrrolidine-3-sulfonate |
| InChIKey | UCIIBAYVKAMDGO-UHFFFAOYSA-M |
| SMILES | C1C(C(=O)N(C1=O)OC(=O)CC2=CC=C(C=C2)C3=NN=CN=N3)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)