CAS 1821100-57-5 is the registry number for [7-Isopropoxy-5-oxo-6-(trifluoromethyl)thiazolo[3,2-a]pyridin-8-yl] acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-oxo-7-propan-2-yloxy-6-(trifluoromethyl)-[1,3]thiazolo[3,2-a]pyridin-8-yl] acetate (CAS 1821100-57-5) is a chemical compound with the molecular formula C13H12F3NO4S and a molecular weight of 335.30 g/mol. IUPAC name: [5-oxo-7-propan-2-yloxy-6-(trifluoromethyl)-[1,3]thiazolo[3,2-a]pyridin-8-yl] acetate. InChIKey: JDJJASVVJUQASI-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO4S |
|---|---|
| Molecular weight | 335.30 g/mol |
| IUPAC name | [5-oxo-7-propan-2-yloxy-6-(trifluoromethyl)-[1,3]thiazolo[3,2-a]pyridin-8-yl] acetate |
| InChIKey | JDJJASVVJUQASI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=O)N2C=CSC2=C1OC(=O)C)C(F)(F)F |
Computed by PubChem (NCBI)