Products 1821143-86-5
CAS 1821143-86-5 is the registry number for 2,8-Dimethyl-3,7-bis(1-methylethyl)-4,6-nonanedione, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
2,8-dimethyl-3,7-di(propan-2-yl)nonane-4,6-dione (CAS 1821143-86-5) is a chemical compound with the molecular formula C17H32O2 and a molecular weight of 268.4 g/mol. IUPAC name: 2,8-dimethyl-3,7-di(propan-2-yl)nonane-4,6-dione. InChIKey: ICHYYNRKRBWTBX-UHFFFAOYSA-N.
| Molecular formula | C17H32O2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 2,8-dimethyl-3,7-di(propan-2-yl)nonane-4,6-dione |
| InChIKey | ICHYYNRKRBWTBX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C)C)C(=O)CC(=O)C(C(C)C)C(C)C |
Computed by PubChem (NCBI)