CAS 1821194-01-7 appears in our catalog under these names: Buspirone Impurity 15, Buspirone Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetamide (CAS 1821194-01-7) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: 2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetamide. InChIKey: LKJFWPVIBGDWHM-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetamide |
| InChIKey | LKJFWPVIBGDWHM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CC(=O)N)CC(=O)N |
Computed by PubChem (NCBI)