Products 1821205-76-8
CAS 1821205-76-8 is the registry number for 3-(1,1′-Biphenyl)-2-yl-5-(1-methyl-1H-pyrazol-4-yl)furo(3,2-b)pyridine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
5-(1-methylpyrazol-4-yl)-3-(2-phenylphenyl)furo[3,2-b]pyridine (CAS 1821205-76-8) is a chemical compound with the molecular formula C23H17N3O and a molecular weight of 351.4 g/mol. IUPAC name: 5-(1-methylpyrazol-4-yl)-3-(2-phenylphenyl)furo[3,2-b]pyridine. InChIKey: QSBNKGGRYOLZND-UHFFFAOYSA-N.
| Molecular formula | C23H17N3O |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 5-(1-methylpyrazol-4-yl)-3-(2-phenylphenyl)furo[3,2-b]pyridine |
| InChIKey | QSBNKGGRYOLZND-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NC3=C(C=C2)OC=C3C4=CC=CC=C4C5=CC=CC=C5 |
Computed by PubChem (NCBI)