CAS 1821280-29-8 appears in our catalog under these names: Sbi-0640756, 95%, SBI-0640756/ 99.83% (existing batch purity), SBI–0640756, SBI-0640756, SBI-0640756, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
6-chloro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (CAS 1821280-29-8) is a chemical compound with the molecular formula C23H14ClFN2O2 and a molecular weight of 404.8 g/mol. IUPAC name: 6-chloro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one. InChIKey: VVWGPQZBDQVQRC-RMKNXTFCSA-N.
| Molecular formula | C23H14ClFN2O2 |
|---|---|
| Molecular weight | 404.8 g/mol |
| IUPAC name | 6-chloro-3-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| InChIKey | VVWGPQZBDQVQRC-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC3=C2C=C(C=C3)Cl)C(=O)/C=C/C4=CC(=CN=C4)F |
Computed by PubChem (NCBI)